C16H22ClNO3 — CID 54193386
tert-butyl (2R,3R)-2-(3-chlorophenyl)-3-hydroxypiperidine-1-carboxylate (PubChem CID 54193386) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-(3-chlorophenyl)-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-2-(3-chlorophenyl)-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 54193386 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl (2R,3R)-2-(3-chlorophenyl)-3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](O)[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H22ClNO3/c1-16(2,3)21-15(20)18-9-5-8-13(19)14(18)11-6-4-7-12(17)10-11/h4,6-7,10,13-14,19H,5,8-9H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | PKBRNRXMYVUWQS-ZIAGYGMSSA-N |
| XLogP | 3.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |