C12H19NO2 — CID 54193514
3-oct-3-enyl-1H-pyrrole-2,5-diol (PubChem CID 54193514) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-oct-3-enyl-1H-pyrrole-2,5-diol.
| Compound Name | 3-oct-3-enyl-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54193514 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-oct-3-enyl-1H-pyrrole-2,5-diol |
| SMILES | CCCCC=CCCc1cc(O)[nH]c1O |
| InChI | InChI=1S/C12H19NO2/c1-2-3-4-5-6-7-8-10-9-11(14)13-12(10)15/h5-6,9,13-15H,2-4,7-8H2,1H3 |
| InChIKey | PKEASLKIQHTAHT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|