C15H14BrN — CID 54194924
2-bromo-N,N-dimethyl-9H-fluoren-9-amine (PubChem CID 54194924) has the molecular formula C15H14BrN and a molecular weight of 288.19 g/mol. Its IUPAC name is 2-bromo-N,N-dimethyl-9H-fluoren-9-amine.
| Compound Name | 2-bromo-N,N-dimethyl-9H-fluoren-9-amine |
|---|---|
| PubChem CID | 54194924 |
| Molecular Formula | C15H14BrN |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-bromo-N,N-dimethyl-9H-fluoren-9-amine |
| SMILES | CN(C)C1c2ccccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C15H14BrN/c1-17(2)15-13-6-4-3-5-11(13)12-8-7-10(16)9-14(12)15/h3-9,15H,1-2H3 |
| InChIKey | PLCWVWTZAXAVCH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |