C31H30ClN3O3S — CID 54196625
methyl 3-[[2-[4-[2-[(4-chlorophenyl)-phenylmethyl]phenyl]piperazin-1-yl]acetyl]amino]thiophene-2-carboxylate (PubChem CID 54196625) has the molecular formula C31H30ClN3O3S and a molecular weight of 560.12 g/mol. Its IUPAC name is methyl 3-[[2-[4-[2-[(4-chlorophenyl)-phenylmethyl]phenyl]piperazin-1-yl]acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[4-[2-[(4-chlorophenyl)-phenylmethyl]phenyl]piperazin-1-yl]acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 54196625 |
| Molecular Formula | C31H30ClN3O3S |
| Molecular Weight | 560.12 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | methyl 3-[[2-[4-[2-[(4-chlorophenyl)-phenylmethyl]phenyl]piperazin-1-yl]acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)CN1CCN(c2ccccc2C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C31H30ClN3O3S/c1-38-31(37)30-26(15-20-39-30)33-28(36)21-34-16-18-35(19-17-34)27-10-6-5-9-25(27)29(22-7-3-2-4-8-22)23-11-13-24(32)14-12-23/h2-15,20,29H,16-19,21H2,1H3,(H,33,36) |
| InChIKey | PMGPIDQSBXARBM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.12 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|