About propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate
propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate (PubChem CID 54197305) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate.
Molecular Properties
| Compound Name | propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate |
| PubChem CID | 54197305 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate |
| SMILES | CC(C)OC(=O)CCN1CCc2ccc(N)cc2C1 |
| InChI | InChI=1S/C15H22N2O2/c1-11(2)19-15(18)6-8-17-7-5-12-3-4-14(16)9-13(12)10-17/h3-4,9,11H,5-8,10,16H2,1-2H3 |
| InChIKey | PMTATSGWRVRQGN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
The IUPAC name of propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate (CID 54197305) is propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate.
What is the SMILES notation for propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
The canonical SMILES for propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate is CC(C)OC(=O)CCN1CCc2ccc(N)cc2C1.
What is the InChIKey of propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
The InChIKey is PMTATSGWRVRQGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-11(2)19-15(18)6-8-17-7-5-12-3-4-14(16)9-13(12)10-17/h3-4,9,11H,5-8,10,16H2,1-2H3.
What are the key properties of propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate?
propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate has a molecular weight of 262.35 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)propanoate is sourced from PubChem (CID 54197305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).