C16H14O2 — CID 54197355
5-methoxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,10,13-hexaen-2-one (PubChem CID 54197355) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-methoxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,10,13-hexaen-2-one.
| Compound Name | 5-methoxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,10,13-hexaen-2-one |
|---|---|
| PubChem CID | 54197355 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 5-methoxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,10,13-hexaen-2-one |
| SMILES | COc1ccc2c(c1)C(=O)C1=CC=CCC1=CC2 |
| InChI | InChI=1S/C16H14O2/c1-18-13-9-8-12-7-6-11-4-2-3-5-14(11)16(17)15(12)10-13/h2-3,5-6,8-10H,4,7H2,1H3 |
| InChIKey | PMTZDMNBZPUYKH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |