C19H37N7O3 — CID 54197449
6-[[(2S)-5-amino-1,5-dioxo-1-pyrrolidin-1-ylpentan-2-yl]amino]-N-[3-(diaminomethylideneamino)propyl]hexanamide (PubChem CID 54197449) has the molecular formula C19H37N7O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 6-[[(2S)-5-amino-1,5-dioxo-1-pyrrolidin-1-ylpentan-2-yl]amino]-N-[3-(diaminomethylideneamino)propyl]hexanamide.
| Compound Name | 6-[[(2S)-5-amino-1,5-dioxo-1-pyrrolidin-1-ylpentan-2-yl]amino]-N-[3-(diaminomethylideneamino)propyl]hexanamide |
|---|---|
| PubChem CID | 54197449 |
| Molecular Formula | C19H37N7O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | 6-[[(2S)-5-amino-1,5-dioxo-1-pyrrolidin-1-ylpentan-2-yl]amino]-N-[3-(diaminomethylideneamino)propyl]hexanamide |
| SMILES | NC(=O)CC[C@H](NCCCCCC(=O)NCCCN=C(N)N)C(=O)N1CCCC1 |
| InChI | InChI=1S/C19H37N7O3/c20-16(27)9-8-15(18(29)26-13-4-5-14-26)23-10-3-1-2-7-17(28)24-11-6-12-25-19(21)22/h15,23H,1-14H2,(H2,20,27)(H,24,28)(H4,21,22,25)/t15-/m0/s1 |
| InChIKey | PMVQUPUPPDXVGC-HNNXBMFYSA-N |
| XLogP | -0.83 |
| TPSA | 168.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|