C18H19N2O4P — CID 54197699
2-[[benzyl(hydroxy)phosphoryl]amino]-2-(1H-indol-2-yl)propanoic acid (PubChem CID 54197699) has the molecular formula C18H19N2O4P and a molecular weight of 358.33 g/mol. Its IUPAC name is 2-[[benzyl(hydroxy)phosphoryl]amino]-2-(1H-indol-2-yl)propanoic acid.
| Compound Name | 2-[[benzyl(hydroxy)phosphoryl]amino]-2-(1H-indol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 54197699 |
| Molecular Formula | C18H19N2O4P |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-[[benzyl(hydroxy)phosphoryl]amino]-2-(1H-indol-2-yl)propanoic acid |
| SMILES | CC(NP(=O)(O)Cc1ccccc1)(C(=O)O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H19N2O4P/c1-18(17(21)22,16-11-14-9-5-6-10-15(14)19-16)20-25(23,24)12-13-7-3-2-4-8-13/h2-11,19H,12H2,1H3,(H,21,22)(H2,20,23,24) |
| InChIKey | PMZVXMMYEJFFNR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|