C20H16N2O3 — CID 88748048
2,2-bis(1H-indol-2-yl)-2-(oxiran-2-yl)acetic acid (PubChem CID 88748048) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2,2-bis(1H-indol-2-yl)-2-(oxiran-2-yl)acetic acid.
| Compound Name | 2,2-bis(1H-indol-2-yl)-2-(oxiran-2-yl)acetic acid |
|---|---|
| PubChem CID | 88748048 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2,2-bis(1H-indol-2-yl)-2-(oxiran-2-yl)acetic acid |
| SMILES | O=C(O)C(c1cc2ccccc2[nH]1)(c1cc2ccccc2[nH]1)C1CO1 |
| InChI | InChI=1S/C20H16N2O3/c23-19(24)20(18-11-25-18,16-9-12-5-1-3-7-14(12)21-16)17-10-13-6-2-4-8-15(13)22-17/h1-10,18,21-22H,11H2,(H,23,24) |
| InChIKey | JAIWKYSVFJNZHG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|