C25H34N4O5 — CID 54199386
4-[[N-acetyl-3-methoxy-4-[(2-methylphenyl)carbamoylamino]anilino]-propylamino]-3-methylbutanoic acid (PubChem CID 54199386) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-[[N-acetyl-3-methoxy-4-[(2-methylphenyl)carbamoylamino]anilino]-propylamino]-3-methylbutanoic acid.
| Compound Name | 4-[[N-acetyl-3-methoxy-4-[(2-methylphenyl)carbamoylamino]anilino]-propylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 54199386 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-[[N-acetyl-3-methoxy-4-[(2-methylphenyl)carbamoylamino]anilino]-propylamino]-3-methylbutanoic acid |
| SMILES | CCCN(CC(C)CC(=O)O)N(C(C)=O)c1ccc(NC(=O)Nc2ccccc2C)c(OC)c1 |
| InChI | InChI=1S/C25H34N4O5/c1-6-13-28(16-17(2)14-24(31)32)29(19(4)30)20-11-12-22(23(15-20)34-5)27-25(33)26-21-10-8-7-9-18(21)3/h7-12,15,17H,6,13-14,16H2,1-5H3,(H,31,32)(H2,26,27,33) |
| InChIKey | PODBOAOSXJHBCP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|