C25H34N4O5 — CID 57296803
4-[N-(3-acetamidopropyl)-3-methoxy-4-[(2-methylphenyl)carbamoylamino]anilino]-3-methylbutanoic acid (PubChem CID 57296803) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-[N-(3-acetamidopropyl)-3-methoxy-4-[(2-methylphenyl)carbamoylamino]anilino]-3-methylbutanoic acid.
| Compound Name | 4-[N-(3-acetamidopropyl)-3-methoxy-4-[(2-methylphenyl)carbamoylamino]anilino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 57296803 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-[N-(3-acetamidopropyl)-3-methoxy-4-[(2-methylphenyl)carbamoylamino]anilino]-3-methylbutanoic acid |
| SMILES | COc1cc(N(CCCNC(C)=O)CC(C)CC(=O)O)ccc1NC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C25H34N4O5/c1-17(14-24(31)32)16-29(13-7-12-26-19(3)30)20-10-11-22(23(15-20)34-4)28-25(33)27-21-9-6-5-8-18(21)2/h5-6,8-11,15,17H,7,12-14,16H2,1-4H3,(H,26,30)(H,31,32)(H2,27,28,33) |
| InChIKey | DDKUCTNJGAAOBG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|