C26H27N3O5 — CID 54200264
methyl 2-[4-[[butanoyl-(4,6-dimethyl-3-nitro-2-pyridinyl)amino]methyl]phenyl]benzoate (PubChem CID 54200264) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is methyl 2-[4-[[butanoyl-(4,6-dimethyl-3-nitro-2-pyridinyl)amino]methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[[butanoyl-(4,6-dimethyl-3-nitro-2-pyridinyl)amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 54200264 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | methyl 2-[4-[[butanoyl-(4,6-dimethyl-3-nitro-2-pyridinyl)amino]methyl]phenyl]benzoate |
| SMILES | CCCC(=O)N(Cc1ccc(-c2ccccc2C(=O)OC)cc1)c1nc(C)cc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H27N3O5/c1-5-8-23(30)28(25-24(29(32)33)17(2)15-18(3)27-25)16-19-11-13-20(14-12-19)21-9-6-7-10-22(21)26(31)34-4/h6-7,9-15H,5,8,16H2,1-4H3 |
| InChIKey | POSPEPOZDLWFMV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|