C25H29N5O4 — CID 18982093
ethyl 3-[butanoyl-[[4-[2-[(E)-N'-hydroxycarbamimidoyl]phenyl]phenyl]methyl]amino]-1-methylpyrazole-4-carboxylate (PubChem CID 18982093) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is ethyl 3-[butanoyl-[[4-[2-[(E)-N'-hydroxycarbamimidoyl]phenyl]phenyl]methyl]amino]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 3-[butanoyl-[[4-[2-[(E)-N'-hydroxycarbamimidoyl]phenyl]phenyl]methyl]amino]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 18982093 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | ethyl 3-[butanoyl-[[4-[2-[(E)-N'-hydroxycarbamimidoyl]phenyl]phenyl]methyl]amino]-1-methylpyrazole-4-carboxylate |
| SMILES | CCCC(=O)N(Cc1ccc(-c2ccccc2/C(N)=N\O)cc1)c1nn(C)cc1C(=O)OCC |
| InChI | InChI=1S/C25H29N5O4/c1-4-8-22(31)30(24-21(16-29(3)27-24)25(32)34-5-2)15-17-11-13-18(14-12-17)19-9-6-7-10-20(19)23(26)28-33/h6-7,9-14,16,33H,4-5,8,15H2,1-3H3,(H2,26,28) |
| InChIKey | INHRVLYVCSXIGB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|