C27H46O4Si — CID 54202282
2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 54202282) has the molecular formula C27H46O4Si and a molecular weight of 462.75 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
|---|---|
| PubChem CID | 54202282 |
| Molecular Formula | C27H46O4Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-7-[(1R)-5-hydroxy-2-propylcyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCC1=CCC(O)[C@@H]1CCC=C=CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C27H46O4Si/c1-7-14-21-18-19-24(28)23(21)17-12-9-13-20-27(25(29)30,22-15-10-8-11-16-22)31-32(5,6)26(2,3)4/h9,18,20,22-24,28H,7-8,10-12,14-17,19H2,1-6H3,(H,29,30)/t13?,23-,24?,27?/m1/s1 |
| InChIKey | PQCDROIMWUZPHW-FJKNGGFKSA-N |
| XLogP | 7.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|