C26H31N3O8S — CID 54203355
(3S)-3-[[2-[[(2S)-2-(benzamidomethyl)butanoyl]-[(3-methylsulfonylphenyl)methyl]amino]acetyl]amino]-4-oxobutanoic acid (PubChem CID 54203355) has the molecular formula C26H31N3O8S and a molecular weight of 545.61 g/mol. Its IUPAC name is (3S)-3-[[2-[[(2S)-2-(benzamidomethyl)butanoyl]-[(3-methylsulfonylphenyl)methyl]amino]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[2-[[(2S)-2-(benzamidomethyl)butanoyl]-[(3-methylsulfonylphenyl)methyl]amino]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54203355 |
| Molecular Formula | C26H31N3O8S |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | (3S)-3-[[2-[[(2S)-2-(benzamidomethyl)butanoyl]-[(3-methylsulfonylphenyl)methyl]amino]acetyl]amino]-4-oxobutanoic acid |
| SMILES | CC[C@@H](CNC(=O)c1ccccc1)C(=O)N(CC(=O)N[C@H](C=O)CC(=O)O)Cc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C26H31N3O8S/c1-3-19(14-27-25(34)20-9-5-4-6-10-20)26(35)29(16-23(31)28-21(17-30)13-24(32)33)15-18-8-7-11-22(12-18)38(2,36)37/h4-12,17,19,21H,3,13-16H2,1-2H3,(H,27,34)(H,28,31)(H,32,33)/t19-,21-/m0/s1 |
| InChIKey | PQTWHDUSGQCAAQ-FPOVZHCZSA-N |
| XLogP | 1.03 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|