About 2-propanimidoyloctanoic acid
2-propanimidoyloctanoic acid (PubChem CID 54204957) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-propanimidoyloctanoic acid.
Molecular Properties
| Compound Name | 2-propanimidoyloctanoic acid |
| PubChem CID | 54204957 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-propanimidoyloctanoic acid |
| SMILES | [H]/N=C(\CC)C(CCCCCC)C(=O)O |
| InChI | InChI=1S/C11H21NO2/c1-3-5-6-7-8-9(11(13)14)10(12)4-2/h9,12H,3-8H2,1-2H3,(H,13,14)/b12-10+ |
| InChIKey | PRWHSNUPPCGUMJ-ZRDIBKRKSA-N |
| XLogP | 3.09 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-propanimidoyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propanimidoyloctanoic acid?
The IUPAC name of 2-propanimidoyloctanoic acid (CID 54204957) is 2-propanimidoyloctanoic acid.
What is the SMILES notation for 2-propanimidoyloctanoic acid?
The canonical SMILES for 2-propanimidoyloctanoic acid is [H]/N=C(\CC)C(CCCCCC)C(=O)O.
What is the InChIKey of 2-propanimidoyloctanoic acid?
The InChIKey is PRWHSNUPPCGUMJ-ZRDIBKRKSA-N. The full InChI is InChI=1S/C11H21NO2/c1-3-5-6-7-8-9(11(13)14)10(12)4-2/h9,12H,3-8H2,1-2H3,(H,13,14)/b12-10+.
What are the key properties of 2-propanimidoyloctanoic acid?
2-propanimidoyloctanoic acid has a molecular weight of 199.29 g/mol, XLogP of 3.09, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propanimidoyloctanoic acid is sourced from PubChem (CID 54204957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).