C22H19ClN4 — CID 54208011
3-[4-(4-chlorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,4-dimethylaniline (PubChem CID 54208011) has the molecular formula C22H19ClN4 and a molecular weight of 374.88 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,4-dimethylaniline.
| Compound Name | 3-[4-(4-chlorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 54208011 |
| Molecular Formula | C22H19ClN4 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-5-pyridin-4-yl-1H-imidazol-2-yl]-2,4-dimethylaniline |
| SMILES | Cc1ccc(N)c(C)c1-c1nc(-c2ccc(Cl)cc2)c(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C22H19ClN4/c1-13-3-8-18(24)14(2)19(13)22-26-20(15-4-6-17(23)7-5-15)21(27-22)16-9-11-25-12-10-16/h3-12H,24H2,1-2H3,(H,26,27) |
| InChIKey | PTXNNCMWALSNOP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|