C24H20ClN3 — CID 54303313
4-[4-(4-chlorophenyl)-2-(2-methyl-6-prop-2-enylphenyl)-1H-imidazol-5-yl]pyridine (PubChem CID 54303313) has the molecular formula C24H20ClN3 and a molecular weight of 385.90 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-2-(2-methyl-6-prop-2-enylphenyl)-1H-imidazol-5-yl]pyridine.
| Compound Name | 4-[4-(4-chlorophenyl)-2-(2-methyl-6-prop-2-enylphenyl)-1H-imidazol-5-yl]pyridine |
|---|---|
| PubChem CID | 54303313 |
| Molecular Formula | C24H20ClN3 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-2-(2-methyl-6-prop-2-enylphenyl)-1H-imidazol-5-yl]pyridine |
| SMILES | C=CCc1cccc(C)c1-c1nc(-c2ccc(Cl)cc2)c(-c2ccncc2)[nH]1 |
| InChI | InChI=1S/C24H20ClN3/c1-3-5-17-7-4-6-16(2)21(17)24-27-22(18-8-10-20(25)11-9-18)23(28-24)19-12-14-26-15-13-19/h3-4,6-15H,1,5H2,2H3,(H,27,28) |
| InChIKey | SFTKVDNNCFUXIS-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|