C16H25N2O6P — CID 54208107
benzyl N-[(2S)-2-aminopentanoyl]-N-(dimethoxyphosphorylmethyl)carbamate (PubChem CID 54208107) has the molecular formula C16H25N2O6P and a molecular weight of 372.36 g/mol. Its IUPAC name is benzyl N-[(2S)-2-aminopentanoyl]-N-(dimethoxyphosphorylmethyl)carbamate.
| Compound Name | benzyl N-[(2S)-2-aminopentanoyl]-N-(dimethoxyphosphorylmethyl)carbamate |
|---|---|
| PubChem CID | 54208107 |
| Molecular Formula | C16H25N2O6P |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | benzyl N-[(2S)-2-aminopentanoyl]-N-(dimethoxyphosphorylmethyl)carbamate |
| SMILES | CCC[C@H](N)C(=O)N(CP(=O)(OC)OC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H25N2O6P/c1-4-8-14(17)15(19)18(12-25(21,22-2)23-3)16(20)24-11-13-9-6-5-7-10-13/h5-7,9-10,14H,4,8,11-12,17H2,1-3H3/t14-/m0/s1 |
| InChIKey | PTZADTWCBIRMRR-AWEZNQCLSA-N |
| XLogP | 2.72 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|