About dimethyl 2-phenylprop-2-enyl phosphite
dimethyl 2-phenylprop-2-enyl phosphite (PubChem CID 54208856) has the molecular formula C11H15O3P
and a molecular weight of 226.21 g/mol. Its IUPAC name is dimethyl 2-phenylprop-2-enyl phosphite.
Molecular Properties
| Compound Name | dimethyl 2-phenylprop-2-enyl phosphite |
| PubChem CID | 54208856 |
| Molecular Formula | C11H15O3P |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | dimethyl 2-phenylprop-2-enyl phosphite |
| SMILES | C=C(COP(OC)OC)c1ccccc1 |
| InChI | InChI=1S/C11H15O3P/c1-10(9-14-15(12-2)13-3)11-7-5-4-6-8-11/h4-8H,1,9H2,2-3H3 |
| InChIKey | PUMLVPMMJYIERA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-phenylprop-2-enyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-phenylprop-2-enyl phosphite?
The IUPAC name of dimethyl 2-phenylprop-2-enyl phosphite (CID 54208856) is dimethyl 2-phenylprop-2-enyl phosphite.
What is the SMILES notation for dimethyl 2-phenylprop-2-enyl phosphite?
The canonical SMILES for dimethyl 2-phenylprop-2-enyl phosphite is C=C(COP(OC)OC)c1ccccc1.
What is the InChIKey of dimethyl 2-phenylprop-2-enyl phosphite?
The InChIKey is PUMLVPMMJYIERA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15O3P/c1-10(9-14-15(12-2)13-3)11-7-5-4-6-8-11/h4-8H,1,9H2,2-3H3.
What are the key properties of dimethyl 2-phenylprop-2-enyl phosphite?
dimethyl 2-phenylprop-2-enyl phosphite has a molecular weight of 226.21 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-phenylprop-2-enyl phosphite is sourced from PubChem (CID 54208856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).