C27H39NO5 — CID 54211812
(2R)-5-[2-(3,5-dimethoxyphenyl)ethyl-methylamino]-2-(3,5-dimethoxy-2-propan-2-ylphenyl)pentanal (PubChem CID 54211812) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is (2R)-5-[2-(3,5-dimethoxyphenyl)ethyl-methylamino]-2-(3,5-dimethoxy-2-propan-2-ylphenyl)pentanal.
| Compound Name | (2R)-5-[2-(3,5-dimethoxyphenyl)ethyl-methylamino]-2-(3,5-dimethoxy-2-propan-2-ylphenyl)pentanal |
|---|---|
| PubChem CID | 54211812 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | (2R)-5-[2-(3,5-dimethoxyphenyl)ethyl-methylamino]-2-(3,5-dimethoxy-2-propan-2-ylphenyl)pentanal |
| SMILES | COc1cc(CCN(C)CCC[C@@H](C=O)c2cc(OC)cc(OC)c2C(C)C)cc(OC)c1 |
| InChI | InChI=1S/C27H39NO5/c1-19(2)27-25(16-24(32-6)17-26(27)33-7)21(18-29)9-8-11-28(3)12-10-20-13-22(30-4)15-23(14-20)31-5/h13-19,21H,8-12H2,1-7H3/t21-/m0/s1 |
| InChIKey | PWLMXMUNSMMCQN-NRFANRHFSA-N |
| XLogP | 5.08 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|