C26H34F3NO3 — CID 57220282
2-(3,5-dimethoxyphenyl)-5-[methyl-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]-2-propan-2-ylpentanal (PubChem CID 57220282) has the molecular formula C26H34F3NO3 and a molecular weight of 465.56 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-5-[methyl-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]-2-propan-2-ylpentanal.
| Compound Name | 2-(3,5-dimethoxyphenyl)-5-[methyl-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]-2-propan-2-ylpentanal |
|---|---|
| PubChem CID | 57220282 |
| Molecular Formula | C26H34F3NO3 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-5-[methyl-[2-[3-(trifluoromethyl)phenyl]ethyl]amino]-2-propan-2-ylpentanal |
| SMILES | COc1cc(OC)cc(C(C=O)(CCCN(C)CCc2cccc(C(F)(F)F)c2)C(C)C)c1 |
| InChI | InChI=1S/C26H34F3NO3/c1-19(2)25(18-31,22-15-23(32-4)17-24(16-22)33-5)11-7-12-30(3)13-10-20-8-6-9-21(14-20)26(27,28)29/h6,8-9,14-19H,7,10-13H2,1-5H3 |
| InChIKey | UUEVKDZMPQFGJY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|