C10H15N3 — CID 54216626
N-[(3-diazocyclohexa-1,5-dien-1-yl)methyl]propan-1-amine (PubChem CID 54216626) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is N-[(3-diazocyclohexa-1,5-dien-1-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-diazocyclohexa-1,5-dien-1-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 54216626 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | N-[(3-diazocyclohexa-1,5-dien-1-yl)methyl]propan-1-amine |
| SMILES | CCCNCC1=CC(=[N+]=[N-])CC=C1 |
| InChI | InChI=1S/C10H15N3/c1-2-6-12-8-9-4-3-5-10(7-9)13-11/h3-4,7,12H,2,5-6,8H2,1H3 |
| InChIKey | ZZXFGYSKBNIYCP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 48.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|