C14H8Cl4 — CID 54217664
1,5,10,10-tetrachloro-9H-anthracene (PubChem CID 54217664) has the molecular formula C14H8Cl4 and a molecular weight of 318.03 g/mol. Its IUPAC name is 1,5,10,10-tetrachloro-9H-anthracene.
| Compound Name | 1,5,10,10-tetrachloro-9H-anthracene |
|---|---|
| PubChem CID | 54217664 |
| Molecular Formula | C14H8Cl4 |
| Molecular Weight | 318.03 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 1,5,10,10-tetrachloro-9H-anthracene |
| SMILES | Clc1cccc2c1Cc1cccc(Cl)c1C2(Cl)Cl |
| InChI | InChI=1S/C14H8Cl4/c15-11-5-2-4-10-9(11)7-8-3-1-6-12(16)13(8)14(10,17)18/h1-6H,7H2 |
| InChIKey | HTVKROJCJHVKRV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.03 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|