C40H22F6O10 — CID 54220156
5-[2-(1,3-dioxoinden-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione;5-[2-(1,3-dioxoinden-5-yl)propan-2-yl]-2-benzofuran-1,3-dione (PubChem CID 54220156) has the molecular formula C40H22F6O10 and a molecular weight of 776.59 g/mol. Its IUPAC name is 5-[2-(1,3-dioxoinden-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione;5-[2-(1,3-dioxoinden-5-yl)propan-2-yl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[2-(1,3-dioxoinden-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione;5-[2-(1,3-dioxoinden-5-yl)propan-2-yl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 54220156 |
| Molecular Formula | C40H22F6O10 |
| Molecular Weight | 776.59 g/mol |
| Exact Mass | 776.11 |
| IUPAC Name | 5-[2-(1,3-dioxoinden-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione;5-[2-(1,3-dioxoinden-5-yl)propan-2-yl]-2-benzofuran-1,3-dione |
| SMILES | CC(C)(c1ccc2c(c1)C(=O)CC2=O)c1ccc2c(c1)C(=O)OC2=O.O=C1CC(=O)c2cc(C(c3ccc4c(c3)C(=O)OC4=O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H8F6O5.C20H14O5/c21-19(22,23)18(20(24,25)26,8-1-3-10-12(5-8)15(28)7-14(10)27)9-2-4-11-13(6-9)17(30)31-16(11)29;1-20(2,10-3-5-12-14(7-10)17(22)9-16(12)21)11-4-6-13-15(8-11)19(24)25-18(13)23/h1-6H,7H2;3-8H,9H2,1-2H3 |
| InChIKey | QBZUPXNORCSKCC-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 155.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.59 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|