C24H19F3O6 — CID 58091740
5-[2-(6,7-dimethyl-1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-4,6,7-trimethyl-2-benzofuran-1,3-dione (PubChem CID 58091740) has the molecular formula C24H19F3O6 and a molecular weight of 460.40 g/mol. Its IUPAC name is 5-[2-(6,7-dimethyl-1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-4,6,7-trimethyl-2-benzofuran-1,3-dione.
| Compound Name | 5-[2-(6,7-dimethyl-1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-4,6,7-trimethyl-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 58091740 |
| Molecular Formula | C24H19F3O6 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 5-[2-(6,7-dimethyl-1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-4,6,7-trimethyl-2-benzofuran-1,3-dione |
| SMILES | Cc1c(C(C)(c2c(C)c(C)c3c(c2C)C(=O)OC3=O)C(F)(F)F)cc2c(c1C)C(=O)OC2=O |
| InChI | InChI=1S/C24H19F3O6/c1-8-9(2)15-13(19(28)32-20(15)29)7-14(8)23(6,24(25,26)27)18-11(4)10(3)16-17(12(18)5)22(31)33-21(16)30/h7H,1-6H3 |
| InChIKey | VKVAQCNVJWOQOI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|