C13H11N3O3 — CID 54222554
2-cyano-3-(2-methoxy-6-methylimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid (PubChem CID 54222554) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-cyano-3-(2-methoxy-6-methylimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid.
| Compound Name | 2-cyano-3-(2-methoxy-6-methylimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54222554 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-cyano-3-(2-methoxy-6-methylimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid |
| SMILES | COc1nc2ccc(C)cn2c1C=C(C#N)C(=O)O |
| InChI | InChI=1S/C13H11N3O3/c1-8-3-4-11-15-12(19-2)10(16(11)7-8)5-9(6-14)13(17)18/h3-5,7H,1-2H3,(H,17,18) |
| InChIKey | QDPWKIMYDGXEIZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|