C27H53NO3 — CID 54226385
N-(2,3-dihydroxypropyl)-N-dodec-6-enyl-3-ethyldecanamide (PubChem CID 54226385) has the molecular formula C27H53NO3 and a molecular weight of 439.73 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-N-dodec-6-enyl-3-ethyldecanamide.
| Compound Name | N-(2,3-dihydroxypropyl)-N-dodec-6-enyl-3-ethyldecanamide |
|---|---|
| PubChem CID | 54226385 |
| Molecular Formula | C27H53NO3 |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 439.40 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-N-dodec-6-enyl-3-ethyldecanamide |
| SMILES | CCCCCC=CCCCCCN(CC(O)CO)C(=O)CC(CC)CCCCCCC |
| InChI | InChI=1S/C27H53NO3/c1-4-7-9-11-12-13-14-15-17-19-21-28(23-26(30)24-29)27(31)22-25(6-3)20-18-16-10-8-5-2/h12-13,25-26,29-30H,4-11,14-24H2,1-3H3 |
| InChIKey | QGDJQVRIHZFXIR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|