C29H54N2O6 — CID 57356745
5-[8-[bis(2-hydroxyethyl)amino]-8-oxooctyl]-2-hexyl-N,N-bis(2-hydroxyethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 57356745) has the molecular formula C29H54N2O6 and a molecular weight of 526.76 g/mol. Its IUPAC name is 5-[8-[bis(2-hydroxyethyl)amino]-8-oxooctyl]-2-hexyl-N,N-bis(2-hydroxyethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | 5-[8-[bis(2-hydroxyethyl)amino]-8-oxooctyl]-2-hexyl-N,N-bis(2-hydroxyethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 57356745 |
| Molecular Formula | C29H54N2O6 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.40 |
| IUPAC Name | 5-[8-[bis(2-hydroxyethyl)amino]-8-oxooctyl]-2-hexyl-N,N-bis(2-hydroxyethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | CCCCCCC1C=CC(CCCCCCCC(=O)N(CCO)CCO)CC1C(=O)N(CCO)CCO |
| InChI | InChI=1S/C29H54N2O6/c1-2-3-4-9-12-26-15-14-25(24-27(26)29(37)31(18-22-34)19-23-35)11-8-6-5-7-10-13-28(36)30(16-20-32)17-21-33/h14-15,25-27,32-35H,2-13,16-24H2,1H3 |
| InChIKey | FAWNXBJWLYWEAG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|