C16H23NO2 — CID 54226738
(4R)-3-methoxy-4-[3-(2-methoxyethenyl)phenyl]-1-methylpiperidine (PubChem CID 54226738) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (4R)-3-methoxy-4-[3-(2-methoxyethenyl)phenyl]-1-methylpiperidine.
| Compound Name | (4R)-3-methoxy-4-[3-(2-methoxyethenyl)phenyl]-1-methylpiperidine |
|---|---|
| PubChem CID | 54226738 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4R)-3-methoxy-4-[3-(2-methoxyethenyl)phenyl]-1-methylpiperidine |
| SMILES | COC=Cc1cccc([C@H]2CCN(C)CC2OC)c1 |
| InChI | InChI=1S/C16H23NO2/c1-17-9-7-15(16(12-17)19-3)14-6-4-5-13(11-14)8-10-18-2/h4-6,8,10-11,15-16H,7,9,12H2,1-3H3/t15-,16?/m1/s1 |
| InChIKey | QGJIBSWBAHEOKE-AAFJCEBUSA-N |
| XLogP | 2.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|