C16H17N5O2 — CID 5422824
8-amino-3-cyclohexyl-1H-benzo[g]pteridine-2,4-dione (PubChem CID 5422824) has the molecular formula C16H17N5O2 and a molecular weight of 311.34 g/mol. Its IUPAC name is 8-amino-3-cyclohexyl-1H-benzo[g]pteridine-2,4-dione.
| Compound Name | 8-amino-3-cyclohexyl-1H-benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 5422824 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 8-amino-3-cyclohexyl-1H-benzo[g]pteridine-2,4-dione |
| SMILES | Nc1ccc2nc3c(=O)n(C4CCCCC4)c(=O)[nH]c3nc2c1 |
| InChI | InChI=1S/C16H17N5O2/c17-9-6-7-11-12(8-9)19-14-13(18-11)15(22)21(16(23)20-14)10-4-2-1-3-5-10/h6-8,10H,1-5,17H2,(H,19,20,23) |
| InChIKey | LNFOKLWJIJKLKY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|