C17H27F3N3O3PS — CID 54228333
2-[[bis(cyclohexylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 54228333) has the molecular formula C17H27F3N3O3PS and a molecular weight of 441.46 g/mol. Its IUPAC name is 2-[[bis(cyclohexylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-[[bis(cyclohexylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 54228333 |
| Molecular Formula | C17H27F3N3O3PS |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[[bis(cyclohexylamino)-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | O=C(O)CN(C(=O)C(F)(F)F)C(NC1CCCCC1)(NC1CCCCC1)P=S |
| InChI | InChI=1S/C17H27F3N3O3PS/c18-16(19,20)15(26)23(11-14(24)25)17(27-28,21-12-7-3-1-4-8-12)22-13-9-5-2-6-10-13/h12-13,21-22H,1-11H2,(H,24,25) |
| InChIKey | UYOOJNHCGWWYHU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|