C21H23F3N3O3PS — CID 88671819
2-[[bis[benzyl(methyl)amino]-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 88671819) has the molecular formula C21H23F3N3O3PS and a molecular weight of 485.47 g/mol. Its IUPAC name is 2-[[bis[benzyl(methyl)amino]-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-[[bis[benzyl(methyl)amino]-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 88671819 |
| Molecular Formula | C21H23F3N3O3PS |
| Molecular Weight | 485.47 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 2-[[bis[benzyl(methyl)amino]-thiophosphorosomethyl]-(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | CN(Cc1ccccc1)C(P=S)(N(C)Cc1ccccc1)N(CC(=O)O)C(=O)C(F)(F)F |
| InChI | InChI=1S/C21H23F3N3O3PS/c1-25(13-16-9-5-3-6-10-16)21(31-32,26(2)14-17-11-7-4-8-12-17)27(15-18(28)29)19(30)20(22,23)24/h3-12H,13-15H2,1-2H3,(H,28,29) |
| InChIKey | WAJHCDWAHJPWEG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|