C8H12F3NO4S — CID 60828301
2-[cyclopentyl(trifluoromethylsulfonyl)amino]acetic acid (PubChem CID 60828301) has the molecular formula C8H12F3NO4S and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-[cyclopentyl(trifluoromethylsulfonyl)amino]acetic acid.
| Compound Name | 2-[cyclopentyl(trifluoromethylsulfonyl)amino]acetic acid |
|---|---|
| PubChem CID | 60828301 |
| Molecular Formula | C8H12F3NO4S |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-[cyclopentyl(trifluoromethylsulfonyl)amino]acetic acid |
| SMILES | O=C(O)CN(C1CCCC1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO4S/c9-8(10,11)17(15,16)12(5-7(13)14)6-3-1-2-4-6/h6H,1-5H2,(H,13,14) |
| InChIKey | LKGUFEYMQIAEDL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |