C17H11Cl3F2N2O3 — CID 54230985
ethyl 2-[(2,4-difluorophenyl)iminomethyl]-3-oxo-3-(4,5,6-trichloro-3-pyridinyl)propanoate (PubChem CID 54230985) has the molecular formula C17H11Cl3F2N2O3 and a molecular weight of 435.64 g/mol. Its IUPAC name is ethyl 2-[(2,4-difluorophenyl)iminomethyl]-3-oxo-3-(4,5,6-trichloro-3-pyridinyl)propanoate.
| Compound Name | ethyl 2-[(2,4-difluorophenyl)iminomethyl]-3-oxo-3-(4,5,6-trichloro-3-pyridinyl)propanoate |
|---|---|
| PubChem CID | 54230985 |
| Molecular Formula | C17H11Cl3F2N2O3 |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | ethyl 2-[(2,4-difluorophenyl)iminomethyl]-3-oxo-3-(4,5,6-trichloro-3-pyridinyl)propanoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(F)cc1F)C(=O)c1cnc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C17H11Cl3F2N2O3/c1-2-27-17(26)10(7-23-12-4-3-8(21)5-11(12)22)15(25)9-6-24-16(20)14(19)13(9)18/h3-7,10H,2H2,1H3/b23-7+ |
| InChIKey | QJFZDSCSLLLGOQ-HCGXMYGOSA-N |
| XLogP | 5.08 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|