C21H30N2O — CID 54232305
O-[amino-phenyl-(2,3,4,5-tetraethylphenyl)methyl]hydroxylamine (PubChem CID 54232305) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is O-[amino-phenyl-(2,3,4,5-tetraethylphenyl)methyl]hydroxylamine.
| Compound Name | O-[amino-phenyl-(2,3,4,5-tetraethylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 54232305 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | O-[amino-phenyl-(2,3,4,5-tetraethylphenyl)methyl]hydroxylamine |
| SMILES | CCc1cc(C(N)(ON)c2ccccc2)c(CC)c(CC)c1CC |
| InChI | InChI=1S/C21H30N2O/c1-5-15-14-20(19(8-4)18(7-3)17(15)6-2)21(22,24-23)16-12-10-9-11-13-16/h9-14H,5-8,22-23H2,1-4H3 |
| InChIKey | QKDAZRQPHNKGJD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|