C20H23NO2 — CID 139037223
(4R)-4-(4-methylphenyl)spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine (PubChem CID 139037223) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (4R)-4-(4-methylphenyl)spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine.
| Compound Name | (4R)-4-(4-methylphenyl)spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 139037223 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (4R)-4-(4-methylphenyl)spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine |
| SMILES | Cc1ccc([C@@]2(N)OOC3(CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H23NO2/c1-15-9-11-16(12-10-15)20(21)18-8-4-3-7-17(18)19(22-23-20)13-5-2-6-14-19/h3-4,7-12H,2,5-6,13-14,21H2,1H3/t20-/m1/s1 |
| InChIKey | GQRLCWHPXAUOAS-HXUWFJFHSA-N |
| XLogP | 4.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|