C20H21N3O2 — CID 72944659
4-azido-4-(4-methylphenyl)spiro[2,3-benzodioxine-1,1'-cyclohexane] (PubChem CID 72944659) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 4-azido-4-(4-methylphenyl)spiro[2,3-benzodioxine-1,1'-cyclohexane].
| Compound Name | 4-azido-4-(4-methylphenyl)spiro[2,3-benzodioxine-1,1'-cyclohexane] |
|---|---|
| PubChem CID | 72944659 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-azido-4-(4-methylphenyl)spiro[2,3-benzodioxine-1,1'-cyclohexane] |
| SMILES | Cc1ccc(C2(N=[N+]=[N-])OOC3(CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H21N3O2/c1-15-9-11-16(12-10-15)20(22-23-21)18-8-4-3-7-17(18)19(24-25-20)13-5-2-6-14-19/h3-4,7-12H,2,5-6,13-14H2,1H3 |
| InChIKey | CFOLPYRBAAAJGR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|