C19H21NO2 — CID 72944656
4-phenylspiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine (PubChem CID 72944656) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-phenylspiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine.
| Compound Name | 4-phenylspiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 72944656 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-phenylspiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine |
| SMILES | NC1(c2ccccc2)OOC2(CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C19H21NO2/c20-19(15-9-3-1-4-10-15)17-12-6-5-11-16(17)18(21-22-19)13-7-2-8-14-18/h1,3-6,9-12H,2,7-8,13-14,20H2 |
| InChIKey | HMOCWNNYMHZSQP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|