C20H20FNO2 — CID 123897535
4-(4-fluorocyclohepta-1,3-dien-5-yn-1-yl)spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine (PubChem CID 123897535) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is 4-(4-fluorocyclohepta-1,3-dien-5-yn-1-yl)spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine.
| Compound Name | 4-(4-fluorocyclohepta-1,3-dien-5-yn-1-yl)spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 123897535 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-(4-fluorocyclohepta-1,3-dien-5-yn-1-yl)spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine |
| SMILES | NC1(C2=CC=C(F)C#CC2)OOC2(CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C20H20FNO2/c21-16-8-6-7-15(11-12-16)20(22)18-10-3-2-9-17(18)19(23-24-20)13-4-1-5-14-19/h2-3,9-12H,1,4-5,7,13-14,22H2 |
| InChIKey | HGWPUJYJKOXCTA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|