C20H20F3NO2 — CID 72944546
4-[4-(trifluoromethyl)phenyl]spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine (PubChem CID 72944546) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)phenyl]spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine.
| Compound Name | 4-[4-(trifluoromethyl)phenyl]spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 72944546 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[4-(trifluoromethyl)phenyl]spiro[2,3-benzodioxine-1,1'-cyclohexane]-4-amine |
| SMILES | NC1(c2ccc(C(F)(F)F)cc2)OOC2(CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C20H20F3NO2/c21-20(22,23)15-10-8-14(9-11-15)19(24)17-7-3-2-6-16(17)18(25-26-19)12-4-1-5-13-18/h2-3,6-11H,1,4-5,12-13,24H2 |
| InChIKey | XBSOXYYLSWGPOU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|