C22H21ClN2O5 — CID 54233713
4-[3-chloro-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]anilino]-4-oxo-2-phenylbut-2-enoic acid (PubChem CID 54233713) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is 4-[3-chloro-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]anilino]-4-oxo-2-phenylbut-2-enoic acid.
| Compound Name | 4-[3-chloro-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]anilino]-4-oxo-2-phenylbut-2-enoic acid |
|---|---|
| PubChem CID | 54233713 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 4-[3-chloro-4-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]anilino]-4-oxo-2-phenylbut-2-enoic acid |
| SMILES | CC1(C)CON(Cc2ccc(NC(=O)C=C(C(=O)O)c3ccccc3)cc2Cl)C1=O |
| InChI | InChI=1S/C22H21ClN2O5/c1-22(2)13-30-25(21(22)29)12-15-8-9-16(10-18(15)23)24-19(26)11-17(20(27)28)14-6-4-3-5-7-14/h3-11H,12-13H2,1-2H3,(H,24,26)(H,27,28) |
| InChIKey | QLBFZKSWXHJOPD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|