C14H19N3OS — CID 54234572
2-[2-(dimethylamino)ethyl]-3a,4-dihydro-3H-imidazo[5,1-c][1,4]benzoxazine-1-thione (PubChem CID 54234572) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-3a,4-dihydro-3H-imidazo[5,1-c][1,4]benzoxazine-1-thione.
| Compound Name | 2-[2-(dimethylamino)ethyl]-3a,4-dihydro-3H-imidazo[5,1-c][1,4]benzoxazine-1-thione |
|---|---|
| PubChem CID | 54234572 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-3a,4-dihydro-3H-imidazo[5,1-c][1,4]benzoxazine-1-thione |
| SMILES | CN(C)CCN1CC2COc3ccccc3N2C1=S |
| InChI | InChI=1S/C14H19N3OS/c1-15(2)7-8-16-9-11-10-18-13-6-4-3-5-12(13)17(11)14(16)19/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | QLQHPYUOTXOXCC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|