C14H13N3O3 — CID 54234987
2-[2-hydroxy-3-(1H-imidazol-2-yl)propyl]isoindole-1,3-dione (PubChem CID 54234987) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(1H-imidazol-2-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-hydroxy-3-(1H-imidazol-2-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54234987 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-[2-hydroxy-3-(1H-imidazol-2-yl)propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC(O)Cc1ncc[nH]1 |
| InChI | InChI=1S/C14H13N3O3/c18-9(7-12-15-5-6-16-12)8-17-13(19)10-3-1-2-4-11(10)14(17)20/h1-6,9,18H,7-8H2,(H,15,16) |
| InChIKey | QLXBULDWOYYEEK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|