C19H24N4 — CID 54236075
(2-cyano-4-methyl-5-phenyl-1-piperidin-1-ylpentylidene)cyanamide (PubChem CID 54236075) has the molecular formula C19H24N4 and a molecular weight of 308.43 g/mol. Its IUPAC name is (2-cyano-4-methyl-5-phenyl-1-piperidin-1-ylpentylidene)cyanamide.
| Compound Name | (2-cyano-4-methyl-5-phenyl-1-piperidin-1-ylpentylidene)cyanamide |
|---|---|
| PubChem CID | 54236075 |
| Molecular Formula | C19H24N4 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (2-cyano-4-methyl-5-phenyl-1-piperidin-1-ylpentylidene)cyanamide |
| SMILES | CC(Cc1ccccc1)CC(C#N)/C(=N\C#N)N1CCCCC1 |
| InChI | InChI=1S/C19H24N4/c1-16(12-17-8-4-2-5-9-17)13-18(14-20)19(22-15-21)23-10-6-3-7-11-23/h2,4-5,8-9,16,18H,3,6-7,10-13H2,1H3/b22-19+ |
| InChIKey | QMQVHPMGBGCPEX-ZBJSNUHESA-N |
| XLogP | 3.76 |
| TPSA | 63.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|