C17H23N5O8S3 — CID 54239183
2-amino-N-butyl-5-[4-(methylsulfonylsulfamoyl)-2-nitroanilino]benzenesulfonamide (PubChem CID 54239183) has the molecular formula C17H23N5O8S3 and a molecular weight of 521.60 g/mol. Its IUPAC name is 2-amino-N-butyl-5-[4-(methylsulfonylsulfamoyl)-2-nitroanilino]benzenesulfonamide.
| Compound Name | 2-amino-N-butyl-5-[4-(methylsulfonylsulfamoyl)-2-nitroanilino]benzenesulfonamide |
|---|---|
| PubChem CID | 54239183 |
| Molecular Formula | C17H23N5O8S3 |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 2-amino-N-butyl-5-[4-(methylsulfonylsulfamoyl)-2-nitroanilino]benzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cc(Nc2ccc(S(=O)(=O)NS(C)(=O)=O)cc2[N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C17H23N5O8S3/c1-3-4-9-19-33(29,30)17-10-12(5-7-14(17)18)20-15-8-6-13(11-16(15)22(23)24)32(27,28)21-31(2,25)26/h5-8,10-11,19-21H,3-4,9,18H2,1-2H3 |
| InChIKey | QOUBTTZYEIKTLO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 207.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|