C22H25N5O8S3 — CID 54439873
2-amino-N-(4-methylphenyl)sulfonyl-5-[2-nitro-4-(propylsulfamoyl)anilino]benzenesulfonamide (PubChem CID 54439873) has the molecular formula C22H25N5O8S3 and a molecular weight of 583.67 g/mol. Its IUPAC name is 2-amino-N-(4-methylphenyl)sulfonyl-5-[2-nitro-4-(propylsulfamoyl)anilino]benzenesulfonamide.
| Compound Name | 2-amino-N-(4-methylphenyl)sulfonyl-5-[2-nitro-4-(propylsulfamoyl)anilino]benzenesulfonamide |
|---|---|
| PubChem CID | 54439873 |
| Molecular Formula | C22H25N5O8S3 |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | 2-amino-N-(4-methylphenyl)sulfonyl-5-[2-nitro-4-(propylsulfamoyl)anilino]benzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc(Nc2ccc(N)c(S(=O)(=O)NS(=O)(=O)c3ccc(C)cc3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25N5O8S3/c1-3-12-24-36(30,31)18-9-11-20(21(14-18)27(28)29)25-16-6-10-19(23)22(13-16)38(34,35)26-37(32,33)17-7-4-15(2)5-8-17/h4-11,13-14,24-26H,3,12,23H2,1-2H3 |
| InChIKey | WNISNTJFVIETNC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 207.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|