C18H25N4O4S+ — CID 9282303
2-[[4-(3,5-dimethylanilino)-3-nitrophenyl]sulfonylamino]ethyl-dimethylazanium (PubChem CID 9282303) has the molecular formula C18H25N4O4S+ and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[[4-(3,5-dimethylanilino)-3-nitrophenyl]sulfonylamino]ethyl-dimethylazanium.
| Compound Name | 2-[[4-(3,5-dimethylanilino)-3-nitrophenyl]sulfonylamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 9282303 |
| Molecular Formula | C18H25N4O4S+ |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[[4-(3,5-dimethylanilino)-3-nitrophenyl]sulfonylamino]ethyl-dimethylazanium |
| SMILES | Cc1cc(C)cc(Nc2ccc(S(=O)(=O)NCC[NH+](C)C)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N4O4S/c1-13-9-14(2)11-15(10-13)20-17-6-5-16(12-18(17)22(23)24)27(25,26)19-7-8-21(3)4/h5-6,9-12,19-20H,7-8H2,1-4H3/p+1 |
| InChIKey | NUCSYFIOBJUHID-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|