C17H21FN4O4S — CID 9250673
N-[2-(dimethylamino)ethyl]-4-(2-fluoro-4-methylanilino)-3-nitrobenzenesulfonamide (PubChem CID 9250673) has the molecular formula C17H21FN4O4S and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(2-fluoro-4-methylanilino)-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(2-fluoro-4-methylanilino)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 9250673 |
| Molecular Formula | C17H21FN4O4S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(2-fluoro-4-methylanilino)-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(Nc2ccc(S(=O)(=O)NCCN(C)C)cc2[N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C17H21FN4O4S/c1-12-4-6-15(14(18)10-12)20-16-7-5-13(11-17(16)22(23)24)27(25,26)19-8-9-21(2)3/h4-7,10-11,19-20H,8-9H2,1-3H3 |
| InChIKey | NIYVKECFYQKJIE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|