C22H34N2O2 — CID 54239868
1,11,11-trimethyl-4-(2,2,6,6-tetramethylpiperidin-4-yl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol (PubChem CID 54239868) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1,11,11-trimethyl-4-(2,2,6,6-tetramethylpiperidin-4-yl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol.
| Compound Name | 1,11,11-trimethyl-4-(2,2,6,6-tetramethylpiperidin-4-yl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 54239868 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 1,11,11-trimethyl-4-(2,2,6,6-tetramethylpiperidin-4-yl)-4-azatricyclo[5.2.2.02,6]undeca-2,5,8-triene-3,5-diol |
| SMILES | CC1(C)CC(n2c(O)c3c(c2O)C2(C)C=CC3C(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C22H34N2O2/c1-19(2)12-22(7)9-8-14(19)15-16(22)18(26)24(17(15)25)13-10-20(3,4)23-21(5,6)11-13/h8-9,13-14,23,25-26H,10-12H2,1-7H3 |
| InChIKey | QPGFIOLPLLFLQL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|